79
Unique InChIKey
1
Unique Sequence
0
EC50 Parameter
15
Unique DOI
BLAST
| OR2L5_OR2L11 | Q8NG80 | 100 | homo sapiens | MENYNQTSTDFILLG ... | MENYNQTSTDFILLG ... |
Showing 31 to 60 of 79 results
Filter Results
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | isobornyl acetate | 247573 | 125-12-2 | KGEKLUUHTZCSIP-JFGNBEQYSA-N | CC(=O)O[C@H]1C[C@H]2CC[C@]1(C2(C)C)C | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | isobutyraldehyde | 6561 | 78-84-2 | AMIMRNSIRUDHCM-UHFFFAOYSA-N | CC(C)C=O | mono | 0 | primaryScreening | 1.0 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | isobutyric acid | 6590 | 79-31-2 | KQNPFQTWMSNSAP-UHFFFAOYSA-N | CC(C)C(=O)O | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | isoeugenol | 853433 | 97-54-1 | BJIOGJUNALELMI-ONEGZZNKSA-N | C/C=C/C1=CC(=C(C=C1)O)OC | mono | 1 | primaryScreening | 1.0 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | isovaleric acid | 10430 | 503-74-2 | GWYFCOCPABKNJV-UHFFFAOYSA-N | CC(C)CC(=O)O | mono | 0 | primaryScreening | 1.0 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | linalool | 6549 | 78-70-6 | CDOSHBSSFJOMGT-UHFFFAOYSA-N | CC(=CCCC(C)(C=C)O)C | sum of isomers | 0 | secondaryScreening | 2 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | methanethiol | 878 | 74-93-1 | LSDPWZHWYPCBBB-UHFFFAOYSA-N | CS | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | methyl salicylate | 4133 | 119-36-8 | OSWPMRLSEDHDFF-UHFFFAOYSA-N | COC(=O)C1=CC=CC=C1O | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | octyl acetate | 8164 | 112-14-1 | YLYBTZIQSIBWLI-UHFFFAOYSA-N | CCCCCCCCOC(=O)C | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | octyl aldehyde | 454 | 124-13-0 | NUJGJRNETVAIRJ-UHFFFAOYSA-N | CCCCCCCC=O | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | pentadecalactone | 235414 | 106-02-5 | FKUPPRZPSYCDRS-UHFFFAOYSA-N | C1CCCCCCCOC(=O)CCCCCC1 | mono | 0 | primaryScreening | 1.0 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | phenyl acetaldehyde | 998 | 122-78-1 | DTUQWGWMVIHBKE-UHFFFAOYSA-N | C1=CC=C(C=C1)CC=O | mono | 1 | primaryScreening | 1.0 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | pyrazine | 9261 | 290-37-9 | KYQCOXFCLRTKLS-UHFFFAOYSA-N | C1=CN=CC=N1 | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | terpineol | 17100 | 98-55-5 | WUOACPNHFRMFPN-UHFFFAOYSA-N | CC1=CCC(CC1)C(C)(C)O | sum of isomers | 0 | primaryScreening | 1 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | terpinyl acetate | 111037 | 80-26-2 | IGODOXYLBBXFDW-UHFFFAOYSA-N | CC1=CCC(CC1)C(C)(C)OC(=O)C | sum of isomers | 0 | primaryScreening | 1 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | undecanal | 8186 | 112-44-7 | KMPQYAYAQWNLME-UHFFFAOYSA-N | CCCCCCCCCCC=O | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | vanillin | 1183 | 121-33-5 | MWOOGOJBHIARFG-UHFFFAOYSA-N | COC1=C(C=CC(=C1)C=O)O | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | lyral | 91604 | 31906-04-4 | ORMHZBNNECIKOH-UHFFFAOYSA-N | CC(C)(CCCC1=CCC(CC1)C=O)O | sum of isomers | 1 | primaryScreening | 1 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | Nootkatone | 1268142 | 4674-50-4 | WTOYNNBCKUYIKC-JMSVASOKSA-N | C[C@@H]1CC(=O)C=C2[C@]1(C[C@@H](CC2)C(=C ... | mono | 1 | primaryScreening | 1 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | 3-Mercaptohexyl acetate | 518810 | JUCARGIKESIVLB-UHFFFAOYSA-N | CCCC(CCOC(=O)C)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | Furaneol | 19309 | INAXVXBDKKUCGI-UHFFFAOYSA-N | CC1C(=O)C(=C(O1)C)O | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | Sotolone | 62835 | UNYNVICDCJHOPO-UHFFFAOYSA-N | CC1C(=C(C(=O)O1)O)C | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | homofuraneol | 33931 | GWCRPYGYVRXVLI-UHFFFAOYSA-N | CCC1C(=O)C(=C(O1)C)O | sum of isomers | 0 | primaryScreening | 1.0 | ||
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | Abhexone | 61199 | IUFQZPBIRYFPFD-UHFFFAOYSA-N | CCC1C(=C(C(=O)O1)O)C | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | Allyl Phenyl acetate | 15717 | 1746-13-0 | ZCDYAMJXVAUTIM-UHFFFAOYSA-N | C=CCOC(=O)CC1=CC=CC=C1 | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | 2,3,5-Trimethylpyrazine | 26808 | 14667-55-1 | IAEGWXHKWJGQAZ-UHFFFAOYSA-N | CC1=CN=C(C(=N1)C)C | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | 2,4,5-trimethyl-4,5-dihydrothiazole | 263626 | 4145-93-1 | CIEKNJJOENYFQL-UHFFFAOYSA-N | CC1C(SC(=N1)C)C | sum of isomers | 0 | primaryScreening | 1.0 | |
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | 3-mercapto-2-methylpentan-1-ol | 6430888 | HABNNYNSJFKZFE-UHFFFAOYSA-N | CCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1.0 | ||
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | 2-methyl-3-sulfanylpropan-1-ol | 529079 | FCIVYWQHILCTLI-UHFFFAOYSA-N | CC(CO)CS | sum of isomers | 0 | primaryScreening | 1.0 | ||
| homo sapiens | OR2L5_OR2L11 | Q8NG80 | MENYNQTSTDFILLG ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 |