54
Unique InChIKey
1
Unique Sequence
1
EC50 Parameter
1
Unique DOI
BLAST
| OR4A4P | Q8NGN8 | 100 | homo sapiens | MEPRKNVTDFVLLGF ... | MEPRKNVTDFVLLGF ... |
Showing 1 to 30 of 54 results
Filter Results
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | n-amyl acetate | 12348 | 628-63-7 | PGMYKACGEOXYJE-UHFFFAOYSA-N | CCCCCOC(=O)C | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | Cyclohexanone | 7967 | 108-94-1 | JHIVVAPYMSGYDF-UHFFFAOYSA-N | C1CCC(=O)CC1 | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | 2-heptanone | 8051 | 110-43-0 | CATSNJVOTSVZJV-UHFFFAOYSA-N | CCCCCC(=O)C | mono | 0 | primaryScreening | 1.0 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | acetophenone | 7410 | 98-86-2 | KWOLFJPFCHCOCG-UHFFFAOYSA-N | CC(=O)C1=CC=CC=C1 | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | 2,4,5-trimethyl-2,5-dihydro-1,3-thiazole | 181287 | 60633-24-1 | AIVVNNYXOSPRCW-UHFFFAOYSA-N | CC1C(=NC(S1)C)C | sum of isomers | 0 | primaryScreening | 1.0 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | (-)-menthol | 16666 | 2216-51-5 | NOOLISFMXDJSKH-KXUCPTDWSA-N | C[C@@H]1CC[C@H]([C@@H](C1)O)C(C)C | mono | 1 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | (+)-menthol | 165675 | 15356-60-2 | NOOLISFMXDJSKH-AEJSXWLSSA-N | C[C@H]1CC[C@@H]([C@H](C1)O)C(C)C | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | 1-butanol | 263 | 71-36-3 | LRHPLDYGYMQRHN-UHFFFAOYSA-N | CCCCO | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | 2-butanone | 6569 | 78-93-3 | ZWEHNKRNPOVVGH-UHFFFAOYSA-N | CCC(=O)C | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | 2-decenal | 5283345 | 3913-71-1 | MMFCJPPRCYDLLZ-CMDGGOBGSA-N | CCCCCCC/C=C/C=O | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | 2-ethylfenchol | 106997 | 18368-91-7 | KIPCKEJKGCXRGA-UHFFFAOYSA-N | CCC1(C(C2CCC1(C2)C)(C)C)O | sum of isomers | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | 2-methoxy-4-methylphenol | 7144 | 93-51-6 | PETRWTHZSKVLRE-UHFFFAOYSA-N | CC1=CC(=C(C=C1)O)OC | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | 4-methylvaleric acid | 12587 | 646-07-1 | FGKJLKRYENPLQH-UHFFFAOYSA-N | CC(C)CCC(=O)O | mono | 0 | primaryScreening | 1.0 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | androstenone | 6852393 | 18339-16-7 | HFVMLYAGWXSTQI-QYXZOKGRSA-N | C[C@]12CC[C@H]3[C@H]([C@@H]1CC=C2)CC[C@@ ... | mono | 1 | secondaryScreening | 2 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | bourgeonal | 64832 | 18127-01-0 | FZJUFJKVIYFBSY-UHFFFAOYSA-N | CC(C)(C)C1=CC=C(C=C1)CCC=O | mono | 0 | primaryScreening | 1.0 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | butyl acetate | 31272 | 123-86-4 | DKPFZGUDAPQIHT-UHFFFAOYSA-N | CCCCOC(=O)C | mono | 0 | primaryScreening | 1.0 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | butyric acid | 264 | 107-92-6 | FERIUCNNQQJTOY-UHFFFAOYSA-N | CCCC(=O)O | mono | 0 | primaryScreening | 1.0 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | caproic acid | 8892 | 142-62-1 | FUZZWVXGSFPDMH-UHFFFAOYSA-N | CCCCCC(=O)O | mono | 0 | primaryScreening | 1.0 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | cineole | 2758 | 470-82-6 | WEEGYLXZBRQIMU-UHFFFAOYSA-N | CC1(C2CCC(O1)(CC2)C)C | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | cis-3-hexen-1-ol | 5281167 | 928-96-1 | UFLHIIWVXFIJGU-ARJAWSKDSA-N | CC/C=C\CCO | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | citral | 638011 | 5392-40-5 | WTEVQBCEXWBHNA-JXMROGBWSA-N | CC(=CCC/C(=C/C=O)/C)C | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | decyl aldehyde | 8175 | 112-31-2 | KSMVZQYAVGTKIV-UHFFFAOYSA-N | CCCCCCCCCC=O | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | diacetyl | 650 | 431-03-8 | QSJXEFYPDANLFS-UHFFFAOYSA-N | CC(=O)C(=O)C | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | diallyl sulfide | 11617 | 592-88-1 | UBJVUCKUDDKUJF-UHFFFAOYSA-N | C=CCSCC=C | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | diphenyl ether | 7583 | 101-84-8 | USIUVYZYUHIAEV-UHFFFAOYSA-N | C1=CC=C(C=C1)OC2=CC=CC=C2 | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | ethylene brassylate | 61014 | 105-95-3 | XRHCAGNSDHCHFJ-UHFFFAOYSA-N | C1CCCCCC(=O)OCCOC(=O)CCCCC1 | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | eugenol acetate | 7136 | 93-28-7 | SCCDQYPEOIRVGX-UHFFFAOYSA-N | CC(=O)OC1=C(C=C(C=C1)CC=C)OC | mono | 0 | secondaryScreening | 3 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | eugenol methyl ether | 7127 | 93-15-2 | ZYEMGPIYFIJGTP-UHFFFAOYSA-N | COC1=C(C=C(C=C1)CC=C)OC | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | (-)-Fenchone | 82229 | 7787-20-4 | LHXDLQBQYFFVNW-OIBJUYFYSA-N | C[C@@]12CC[C@@H](C1)C(C2=O)(C)C | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A4P | Q8NGN8 | MEPRKNVTDFVLLGF ... | galaxolide | 91497 | 1222-05-5 | ONKNPOPIGWHAQC-UHFFFAOYSA-N | CC1COCC2=CC3=C(C=C12)C(C(C3(C)C)C)(C)C | sum of isomers | 1 | primaryScreening | 1 |