84
Unique InChIKey
3
Unique Sequence
0
EC50 Parameter
16
Unique DOI
BLAST
Showing 31 to 60 of 99 results
Filter Results
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | geranyl acetate | 1549026 | 105-87-3 | HIGQPQRQIQDZMP-DHZHZOJOSA-N | CC(=CCC/C(=C/COC(=O)C)/C)C | mono | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | guaiacol | 460 | 90-05-1 | LHGVFZTZFXWLCP-UHFFFAOYSA-N | COC1=CC=CC=C1O | mono | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | heptyl acetate | 8159 | 112-06-1 | ZCZSIDMEHXZRLG-UHFFFAOYSA-N | CCCCCCCOC(=O)C | mono | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | hexyl butyrate | 17525 | 2639-63-6 | XAPCMTMQBXLDBB-UHFFFAOYSA-N | CCCCCCOC(=O)CCC | mono | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | isobornyl acetate | 247573 | 125-12-2 | KGEKLUUHTZCSIP-JFGNBEQYSA-N | CC(=O)O[C@H]1C[C@H]2CC[C@]1(C2(C)C)C | mono | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | isobutyraldehyde | 6561 | 78-84-2 | AMIMRNSIRUDHCM-UHFFFAOYSA-N | CC(C)C=O | mono | 0 | primaryScreening | 1.0 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | isobutyric acid | 6590 | 79-31-2 | KQNPFQTWMSNSAP-UHFFFAOYSA-N | CC(C)C(=O)O | mono | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | isoeugenol | 853433 | 97-54-1 | BJIOGJUNALELMI-ONEGZZNKSA-N | C/C=C/C1=CC(=C(C=C1)O)OC | mono | 0 | primaryScreening | 1.0 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | isovaleric acid | 10430 | 503-74-2 | GWYFCOCPABKNJV-UHFFFAOYSA-N | CC(C)CC(=O)O | mono | 0 | primaryScreening | 1.0 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | linalool | 6549 | 78-70-6 | CDOSHBSSFJOMGT-UHFFFAOYSA-N | CC(=CCCC(C)(C=C)O)C | sum of isomers | 0 | primaryScreening | 1.0 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | methanethiol | 878 | 74-93-1 | LSDPWZHWYPCBBB-UHFFFAOYSA-N | CS | mono | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | methyl salicylate | 4133 | 119-36-8 | OSWPMRLSEDHDFF-UHFFFAOYSA-N | COC(=O)C1=CC=CC=C1O | mono | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | octyl acetate | 8164 | 112-14-1 | YLYBTZIQSIBWLI-UHFFFAOYSA-N | CCCCCCCCOC(=O)C | mono | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | octyl aldehyde | 454 | 124-13-0 | NUJGJRNETVAIRJ-UHFFFAOYSA-N | CCCCCCCC=O | mono | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | pentadecalactone | 235414 | 106-02-5 | FKUPPRZPSYCDRS-UHFFFAOYSA-N | C1CCCCCCCOC(=O)CCCCCC1 | mono | 0 | primaryScreening | 1.0 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | phenyl acetaldehyde | 998 | 122-78-1 | DTUQWGWMVIHBKE-UHFFFAOYSA-N | C1=CC=C(C=C1)CC=O | mono | 0 | primaryScreening | 1.0 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | pyrazine | 9261 | 290-37-9 | KYQCOXFCLRTKLS-UHFFFAOYSA-N | C1=CN=CC=N1 | mono | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | terpineol | 17100 | 98-55-5 | WUOACPNHFRMFPN-UHFFFAOYSA-N | CC1=CCC(CC1)C(C)(C)O | sum of isomers | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | terpinyl acetate | 111037 | 80-26-2 | IGODOXYLBBXFDW-UHFFFAOYSA-N | CC1=CCC(CC1)C(C)(C)OC(=O)C | sum of isomers | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | undecanal | 8186 | 112-44-7 | KMPQYAYAQWNLME-UHFFFAOYSA-N | CCCCCCCCCCC=O | mono | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | vanillin | 1183 | 121-33-5 | MWOOGOJBHIARFG-UHFFFAOYSA-N | COC1=C(C=CC(=C1)C=O)O | mono | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | methyl benzoate | 7150 | 93-58-3 | QPJVMBTYPHYUOC-UHFFFAOYSA-N | COC(=O)C1=CC=CC=C1 | mono | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | 2,4-DNT | 8461 | 121-14-2 | RMBFBMJGBANMMK-UHFFFAOYSA-N | CC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] | mono | 0 | primaryScreening | 1 |
| homo sapiens | OR5B2 | Q96R09 | M200T | MENCTEVTKFILLGL ... | 2,4,5-trimethyl-2,5-dihydro-1,3-thiazole | 181287 | 60633-24-1 | AIVVNNYXOSPRCW-UHFFFAOYSA-N | CC1C(=NC(S1)C)C | sum of isomers | 0 | secondaryScreening | 3 |
| homo sapiens | OR5B2 | Q96R09 | MENCTEVTKFILLGL ... | 3-Mercaptohexyl acetate | 518810 | JUCARGIKESIVLB-UHFFFAOYSA-N | CCCC(CCOC(=O)C)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR5B2 | Q96R09 | E6D | MENCTDVTKFILLGL ... | 3-Mercaptohexyl acetate | 518810 | JUCARGIKESIVLB-UHFFFAOYSA-N | CCCC(CCOC(=O)C)S | sum of isomers | 0 | primaryScreening | 1 | |
| homo sapiens | OR5B2 | Q96R09 | MENCTEVTKFILLGL ... | Furaneol | 19309 | INAXVXBDKKUCGI-UHFFFAOYSA-N | CC1C(=O)C(=C(O1)C)O | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR5B2 | Q96R09 | E6D | MENCTDVTKFILLGL ... | Furaneol | 19309 | INAXVXBDKKUCGI-UHFFFAOYSA-N | CC1C(=O)C(=C(O1)C)O | sum of isomers | 0 | primaryScreening | 1 | |
| homo sapiens | OR5B2 | Q96R09 | MENCTEVTKFILLGL ... | Sotolone | 62835 | UNYNVICDCJHOPO-UHFFFAOYSA-N | CC1C(=C(C(=O)O1)O)C | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR5B2 | Q96R09 | E6D | MENCTDVTKFILLGL ... | Sotolone | 62835 | UNYNVICDCJHOPO-UHFFFAOYSA-N | CC1C(=C(C(=O)O1)O)C | sum of isomers | 0 | primaryScreening | 1 |