1
Unique InChIKey
50
Unique Sequence
0
EC50 Parameter
3
Unique DOI
Showing 31 to 50 of 50 results
Filter Results
| mus musculus | Olfr992 | Q8VGC6 | MKHSNDSKVTEFILL ... | Isobornyl acetate | 6448 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | ||
| mus musculus | Olfr1098 | A2AVB0 | MSACNPTNEPEFMLV ... | Isobornyl acetate | 6448 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | ||
| mus musculus | Olfr1413 | Q8VGU3 | MATQVHRNGSLSAVS ... | Isobornyl acetate | 6448 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | ||
| mus musculus | Olfr599 | Q8VG01 | MGYTNLSYLNPGTVI ... | Isobornyl acetate | 6448 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | ||
| mus musculus | Olfr554 | E9Q546 | MSTFHNVCSVPSSLW ... | Isobornyl acetate | 6448 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | ||
| mus musculus | Olfr569 | Q8VGZ2 | MVASSNSSSHPLFFM ... | Isobornyl acetate | 6448 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | ||
| mus musculus | Olfr686 | Q8VGX3 | MIFSNNSHLLPHTFF ... | Isobornyl acetate | 6448 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | ||
| mus musculus | Olfr620 | E9PZ66 | MTALSVTNYTSSRFA ... | Isobornyl acetate | 6448 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | ||
| mus musculus | Olfr638 | Q8VH20 | MLRPSSMSEVTNTTH ... | Isobornyl acetate | 6448 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | ||
| mus musculus | Olfr575 | Q8VH16 | MLVKSSIMSVLNSSE ... | Isobornyl acetate | 6448 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | ||
| mus musculus | Olfr609 | E9Q4X7 | MSYSNHSSTSFFLTG ... | Isobornyl acetate | 6448 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | ||
| homo sapiens | OR2B3_OR2B3P | O76000 | MNWENESSPKEFILL ... | bornyl acetate | 6448 | 76-49-3 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | |
| homo sapiens | OR2M4 | Q96R27 | MVWENQTFNSIFILL ... | bornyl acetate | 6448 | 76-49-3 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | |
| homo sapiens | OR2T34 | Q8NGX1 | MCSGNQTSQNQTAST ... | bornyl acetate | 6448 | 76-49-3 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | |
| homo sapiens | OR5B17_OR5B20P | Q8NGF7 | MENNTEVSEFILLGL ... | bornyl acetate | 6448 | 76-49-3 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | |
| homo sapiens | OR1L3 | Q8NH93 | MGMSNLTRLSEFILL ... | bornyl acetate | 6448 | 76-49-3 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | |
| homo sapiens | OR2G2 | Q8NGZ5 | MGMVRHTNESNLAGF ... | bornyl acetate | 6448 | 76-49-3 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | |
| homo sapiens | OR2T10 | Q8NGZ9 | MRLANQTLGGDFFLL ... | bornyl acetate | 6448 | 76-49-3 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | |
| homo sapiens | OR5AC2 | Q9NZP5 | MDISEGNKTLVTEFV ... | bornyl acetate | 6448 | 76-49-3 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 | |
| homo sapiens | OR1G1_OR1G2 | P47890 | MEGKNLTSISECFLL ... | bornyl acetate | 6448 | 76-49-3 | KGEKLUUHTZCSIP-UHFFFAOYSA-N | CC(=O)OC1CC2CCC1(C2(C)C)C | sum of isomers | 0 | secondaryScreening | 3 |