771
Unique InChIKey
1402
Unique Sequence
5872
EC50 Parameter
Results
Showing 31861 to 31890 of 53444 results
| mus musculus | Olfr547_Olfr548 | E9PXN3 | MTTLNYTVVSHTVFH ... | D-Carvone | 16724 | 2244-16-8 | ULDHMXUKGWMISQ-VIFPVBQESA-N | CC1=CC[C@@H](CC1=O)C(=C)C | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR13H1 | Q8NG92 | MAMDNVTAVFQFLLI ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR52E8 | Q6IFG1 | MAGRMSTSNHTQFHP ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR1L3 | Q8NH93 | MGMSNLTRLSEFILL ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR2L13_OR2L14 | Q8N349 | MEKWNHTSNDFILLG ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR4C12 | Q96R67 | MEKKKNVTEFILIGL ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR5AC2 | Q9NZP5 | MDISEGNKTLVTEFV ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR6A2_OR6A1_OR6A2P | O95222 | MEWRNHSGRVSEFVL ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR8B3 | Q8NGG8 | MLARNNSLVTEFILA ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR10G7 | Q8NGN6 | MSNATLLTAFILTGL ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR13J1 | Q8NGT2 | MEPLNRTEVSEFFLK ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR52H1 | Q8NGJ2 | MPSASAMIIFNLSSY ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR1L4_OR1L5 | Q8NGR5 | METKNYSSSTSGFIL ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR2L2_OR2L12_OR2L4P | Q8NH16 | MENYNQTSTDFILLG ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR4C13 | Q8NGP0 | MANRNNVTEFILLGL ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| mus musculus | Olfr547_Olfr548 | E9PXN3 | MTTLNYTVVSHTVFH ... | Butyl Butyrate | 7983 | 109-21-7 | XUPYJHCZDLZNFP-UHFFFAOYSA-N | CCCCOC(=O)CCC | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR5AK2 | Q8NH90 | MTLGNSTEVTEFYLL ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR6B1 | O95007 | MELENQTRVTKFILV ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR8B4_OR8B4P | Q96RC9 | MTLRNSSSVTEFILV ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR10G8 | Q8NGN5 | MSNASLLTAFILMGL ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR52I1 | Q8NGK6 | MLGPAYNHTMETPAS ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR1L6_OR1L7 | Q8NGR2 | MSYFYRLKLMKEAVL ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR2L3 | Q8NG85 | MENYNQTSTDFILLG ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR4C15 | Q8NGM1 | MQNQSFVTEFVLLGL ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR5AN1 | Q8NGI8 | MTGGGNITEITYFIL ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR6B2_OR6B2P | Q6IFH4 | MSGENVTKVSTFILV ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR8B8 | Q15620 | MAAENSSFVTQFILA ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR10G9_OR10G10P | Q8NGN4 | MSKTSLVTAFILTGL ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR14A16_OR5AT1 | Q8NHC5 | MANLTIVTEFILMGF ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR52I2 | Q8NH67 | MCQQILRDCILLIHH ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 |