banner
molecules
Showing 721 to 750 of 768 results
 
Name
CAS
Mixture
CID
InChIKey
Smiles
Nonalactone mono 138644 FTXUQEKXCJSWMO-UHFFFAOYSA-N C1CCCCOC(=O)CCC1
Cinnamyl nitrile mono 1550846 ZWKNLRXFUTWSOY-QPJJXVBHSA-N C1=CC=C(C=C1)/C=C/C#N
Clonal mono 17092 VXCUURYYWGCLIH-UHFFFAOYSA-N CCCCCCCCCCCC#N
2-Phenoxyethyl isobutyrate mono 61005 MJTPMXWJHPOWGH-UHFFFAOYSA-N CC(C)C(=O)OCCOC1=CC=CC=C1
5-Methylindole mono 11978 YPKBCLZFIYBSHK-UHFFFAOYSA-N CC1=CC2=C(C=C1)NC=C2
Ethyl phenyl glycidate sum of isomers 8469 GOMAKLPNAAZVCJ-UHFFFAOYSA-N CCOC(=O)C1C(O1)C2=CC=CC=C2
Anisyl acetate mono 7695 HFNGYHHRRMSKEU-UHFFFAOYSA-N CC(=O)OCC1=CC=C(C=C1)OC
Geranyl formate mono 5282109 FQMZVFJYMPNUCT-YRNVUSSQSA-N CC(=CCC/C(=C/COC=O)/C)C
Neryl acetate mono 1549025 HIGQPQRQIQDZMP-FLIBITNWSA-N CC(=CCC/C(=C\COC(=O)C)/C)C
delta-Nonalactone sum of isomers 18698 PXRBWNLUQYZAAX-UHFFFAOYSA-N CCCCC1CCCC(=O)O1
delta-tridecalactone sum of isomers 110977 RZZLMGATMUAJPX-UHFFFAOYSA-N CCCCCCCCC1CCCC(=O)O1
Geranyl propionate mono 5355853 BYCHQEILESTMQU-FMIVXFBMSA-N CCC(=O)OC/C=C(\C)/CCC=C(C)C
para-methoxyacetophenone mono 7476 NTPLXRHDUXRPNE-UHFFFAOYSA-N CC(=O)C1=CC=C(C=C1)OC
Tetrahydro citral sum of isomers 110747 UCSIFMPORANABL-UHFFFAOYSA-N CC(C)CCCC(C)CC=O
Geranyl butyrate mono 5355856 ZSBOMYJPSRFZAL-JLHYYAGUSA-N CCCC(=O)OC/C=C(\C)/CCC=C(C)C
1-Methylindole mono 11781 BLRHMMGNCXNXJL-UHFFFAOYSA-N CN1C=CC2=CC=CC=C21
Methyl nicotinate mono 7151 YNBADRVTZLEFNH-UHFFFAOYSA-N COC(=O)C1=CN=CC=C1
musk tibetene mono 67350 MINYPECWDZURGR-UHFFFAOYSA-N CC1=C(C(=C(C(=C1C)[N+](=O)[O-])C(C)(C)C) ...
Cosmone sum of isomers 54543965 ZFGBKXBPHOUSJX-UHFFFAOYSA-N CC1CC=CCCCCCCCCC(=O)C1
1-(3,3-dimethylcyclohexyl)ethyl acetate sum of isomers 91339 YWVSYRJWCROMKO-UHFFFAOYSA-N CC(C1CCCC(C1)(C)C)OC(=O)C
2-methylhexanoic acid sum of isomers 20653 CVKMFSAVYPAZTQ-UHFFFAOYSA-N CCCCC(C)C(=O)O
3-methylhexanoic acid sum of isomers 95315 NZQMQVJXSRMTCJ-UHFFFAOYSA-N CCCC(C)CC(=O)O
(E)-3-methyl-2-hexenoic acid mono 6443739 NTWSIWWJPQHFTO-AATRIKPKSA-N CCC/C(=C/C(=O)O)/C
3-hydroxy-3-methylhexanoic acid sum of isomers 16666688 RGRNSTGIHROKJB-UHFFFAOYSA-N CCCC(C)(CC(=O)O)O
2-methylheptanoic acid sum of isomers 14475 NKBWMBRPILTCRD-UHFFFAOYSA-N CCCCCC(C)C(=O)O
2-Ethyl-3,5-dimethylpyrazine mono 26334 JZBCTZLGKSYRSF-UHFFFAOYSA-N CCC1=NC=C(N=C1C)C
2-sec-Butyl-3-methoxypyridine sum of isomers 91343894 CHCKBDDEJDVRSJ-UHFFFAOYSA-N CCC(C)C1=C(C=CC=N1)OC
2-isobutyl-3-methoxypyridine mono 58531255 ZBYPSGBBPAPHDG-UHFFFAOYSA-N CC(C)CC1=C(C=CC=N1)OC
5-norbornene-2-carboxylic acid sum of isomers 78949 FYGUSUBEMUKACF-UHFFFAOYSA-N C1C2CC(C1C=C2)C(=O)O
Ethyl 2-mercaptopropionate sum of isomers 519709 LXXNWCFBZHKFPT-UHFFFAOYSA-N CCOC(=O)C(C)S