80
Unique InChIKey
2
Unique Sequence
0
EC50 Parameter
15
Unique DOI
BLAST
Showing 61 to 90 of 94 results
Filter Results
| homo sapiens | OR4A47 | Q6IF82 | I104L_V145M | MEPRKNVTDFVLLGF ... | 1,1,6-Trimethyl-1,2-dihydronaphthalene | 121677 | RTUMCNDCAVLXEP-UHFFFAOYSA-N | CC1=CC2=C(C=C1)C(CC=C2)(C)C | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | 3-Mercaptohexyl acetate | 518810 | JUCARGIKESIVLB-UHFFFAOYSA-N | CCCC(CCOC(=O)C)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | Furaneol | 19309 | INAXVXBDKKUCGI-UHFFFAOYSA-N | CC1C(=O)C(=C(O1)C)O | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | Sotolone | 62835 | UNYNVICDCJHOPO-UHFFFAOYSA-N | CC1C(=C(C(=O)O1)O)C | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | homofuraneol | 33931 | GWCRPYGYVRXVLI-UHFFFAOYSA-N | CCC1C(=O)C(=C(O1)C)O | sum of isomers | 0 | primaryScreening | 1.0 | ||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | Abhexone | 61199 | IUFQZPBIRYFPFD-UHFFFAOYSA-N | CCC1C(=C(C(=O)O1)O)C | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | Allyl Phenyl acetate | 15717 | 1746-13-0 | ZCDYAMJXVAUTIM-UHFFFAOYSA-N | C=CCOC(=O)CC1=CC=CC=C1 | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | 2,3,5-Trimethylpyrazine | 26808 | 14667-55-1 | IAEGWXHKWJGQAZ-UHFFFAOYSA-N | CC1=CN=C(C(=N1)C)C | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | 2,4,5-trimethyl-4,5-dihydrothiazole | 263626 | 4145-93-1 | CIEKNJJOENYFQL-UHFFFAOYSA-N | CC1C(SC(=N1)C)C | sum of isomers | 0 | primaryScreening | 1.0 | |
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | 3-mercapto-2-methylpentan-1-ol | 6430888 | HABNNYNSJFKZFE-UHFFFAOYSA-N | CCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1.0 | ||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | 2-methyl-3-sulfanylpropan-1-ol | 529079 | FCIVYWQHILCTLI-UHFFFAOYSA-N | CC(CO)CS | sum of isomers | 0 | primaryScreening | 1.0 | ||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | 2-Methyl-3-sulfanylheptan-1-ol | 21997288 | OCZSUTGSYBERRF-UHFFFAOYSA-N | CCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | 3-Mercapto-2-methyloctan-1-ol | CCCCCC(C(C)CO)S | sum of isomers | 0 | primaryScreening | 1.0 | ||||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | (+/-)-Muscone | 10947 | 541-91-3 | ALHUZKCOMYUFRB-UHFFFAOYSA-N | CC1CCCCCCCCCCCCC(=O)C1 | sum of isomers | 0 | primaryScreening | 1.0 | |
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | Musk xylol | 62329 | XMWRWTSZNLOZFN-UHFFFAOYSA-N | CC1=C(C(=C(C(=C1[N+](=O)[O-])C(C)(C)C)[N ... | mono | 0 | primaryScreening | 1 | ||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | musk ketone | 6669 | WXCMHFPAUCOJIG-UHFFFAOYSA-N | CC1=C(C(=C(C(=C1[N+](=O)[O-])C(C)(C)C)[N ... | mono | 0 | primaryScreening | 1 | ||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | (Z)-4-undecenal | 5362881 | QGNDNDFXCNBMKI-FPLPWBNLSA-N | CCCCCC/C=C\CCC=O | mono | 0 | primaryScreening | 1 | ||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | 3-Methyl-2,4-nonanedione | 529481 | BGVBGAIWXAXBLP-UHFFFAOYSA-N | CCCCCC(=O)C(C)C(=O)C | sum of isomers | 0 | secondaryScreening | 2 | ||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | (e)-8-Cyclohexadecen-1-one | 5362739 | ZGEHHVDYDNXYMW-UPHRSURJSA-N | C1CCC/C=C\CCCCCCC(=O)CCC1 | mono | 0 | primaryScreening | 1 | ||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | (5E)-3-methylcyclopentadec-5-en-1-one | 9834606 | NKMKFQCVDZVEJR-CSKARUKUSA-N | CC1C/C=C/CCCCCCCCCC(=O)C1 | mono | 0 | primaryScreening | 1 | ||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | Ambrettolide | 5365703 | NVIPUOMWGQAOIT-RQOWECAXSA-N | C1CCCCOC(=O)CCCCC/C=C\CCC1 | mono | 0 | primaryScreening | 1 | ||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | Galaxolide | 91497 | ONKNPOPIGWHAQC-UHFFFAOYSA-N | CC1COCC2=CC3=C(C=C12)C(C(C3(C)C)C)(C)C | sum of isomers | 0 | primaryScreening | 1 | ||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | L-Carvone | 439570 | 6485-40-1 | ULDHMXUKGWMISQ-SECBINFHSA-N | CC1=CC[C@H](CC1=O)C(=C)C | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | D-Carvone | 16724 | 2244-16-8 | ULDHMXUKGWMISQ-VIFPVBQESA-N | CC1=CC[C@@H](CC1=O)C(=C)C | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | cis-3-hexanol | 5281167 | 928-96-1 | UFLHIIWVXFIJGU-ARJAWSKDSA-N | CC/C=C\CCO | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | anis aldehyde | 31244 | 123-11-5 | ZRSNZINYAWTAHE-UHFFFAOYSA-N | COC1=CC=C(C=C1)C=O | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | methyl beta-naphthyl ketone | 7122 | 93-08-3 | XSAYZAUNJMRRIR-UHFFFAOYSA-N | CC(=O)C1=CC2=CC=CC=C2C=C1 | mono | 0 | primaryScreening | 1 | |
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | linalool | 6549 | 78-70-6 | CDOSHBSSFJOMGT-UHFFFAOYSA-N | CC(=CCCC(C)(C=C)O)C | sum of isomers | 0 | primaryScreening | 1.0 | |
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | cis-3-hexenol trans-2-hexenal | UFLHIIWVXFIJGU-ARJAWSKDSA-N MB ... | CC/C=C\CCO CCC/C=C/C=O | mixture | 0 | primaryScreening | 1 | |||
| homo sapiens | OR4A47 | Q6IF82 | MEPRKNVTDFVLLGF ... | MCMP | XSAYZAUNJMRRIR-UHFFFAOYSA-N UL ... | CC(=O)C1=CC2=CC=CC=C2C=C1 CC1=CC[C@H](CC ... | mixture | 0 | primaryScreening | 1 |