banner
molecules
Showing 1 to 30 of 768 results
 
Name
CAS
Mixture
CID
InChIKey
Smiles
1-butoxy-2-propanol 5131-66-8 sum of isomers 21210 RWNUSVWFHDHRCJ-UHFFFAOYSA-N CCCCOCC(C)O
2-methyl-1-butanol 137-32-6 sum of isomers 8723 QPRQEDXDYOZYLA-UHFFFAOYSA-N CCC(C)CO
alpha-pinene 80-56-8 sum of isomers 6654 GRWFGVWFFZKLTI-UHFFFAOYSA-N CC1=CCC2CC1C2(C)C
beta-pinene 127-91-3 sum of isomers 14896 WTARULDDTDQWMU-UHFFFAOYSA-N CC1(C2CCC(=C)C1C2)C
lactic acid 50-21-5 sum of isomers 612 JVTAAEKCZFNVCJ-UHFFFAOYSA-N CC(C(=O)O)O
lilial 80-54-6 sum of isomers 228987 SDQFDHOLCGWZPU-UHFFFAOYSA-N CC(CC1=CC=C(C=C1)C(C)(C)C)C=O
linalool 78-70-6 sum of isomers 6549 CDOSHBSSFJOMGT-UHFFFAOYSA-N CC(=CCCC(C)(C=C)O)C
lyral 31906-04-4 sum of isomers 91604 ORMHZBNNECIKOH-UHFFFAOYSA-N CC(C)(CCCC1=CCC(CC1)C=O)O
(+/-)-Muscone 541-91-3 sum of isomers 10947 ALHUZKCOMYUFRB-UHFFFAOYSA-N CC1CCCCCCCCCCCCC(=O)C1
sotolon 28664-35-9 sum of isomers 62835 UNYNVICDCJHOPO-UHFFFAOYSA-N CC1C(=C(C(=O)O1)O)C
5H-5-Methyl-6,7-dihydrocyclopenta-[b]pyrazine sum of isomers 32065 YZEFQPIMXZVPKP-UHFFFAOYSA-N CC1CCC2=NC=CN=C12
2-(Butan-2-yl)-3-methoxypyrazine sum of isomers 520098 QMQDJVIJVPEQHE-UHFFFAOYSA-N CCC(C)C1=NC=CN=C1OC
3-Phenylbutyraldehyde 16251-77-7 sum of isomers 85979 MYHGOWDLVRDUFA-UHFFFAOYSA-N CC(CC=O)C1=CC=CC=C1
2,4,5-trimethyl-2,5-dihydro-1,3-thiazole 60633-24-1 sum of isomers 181287 AIVVNNYXOSPRCW-UHFFFAOYSA-N CC1C(=NC(S1)C)C
2-ethylfenchol 18368-91-7 sum of isomers 106997 KIPCKEJKGCXRGA-UHFFFAOYSA-N CCC1(C(C2CCC1(C2)C)(C)C)O
terpineol 98-55-5 sum of isomers 17100 WUOACPNHFRMFPN-UHFFFAOYSA-N CC1=CCC(CC1)C(C)(C)O
terpinyl acetate 80-26-2 sum of isomers 111037 IGODOXYLBBXFDW-UHFFFAOYSA-N CC1=CCC(CC1)C(C)(C)OC(=O)C
galaxolide 1222-05-5 sum of isomers 91497 ONKNPOPIGWHAQC-UHFFFAOYSA-N CC1COCC2=CC3=C(C=C12)C(C(C3(C)C)C)(C)C
2,4,5-trimethyl-4,5-dihydrothiazole sum of isomers 263626 CIEKNJJOENYFQL-UHFFFAOYSA-N CC1C(SC(=N1)C)C
furaneol sum of isomers 19309 INAXVXBDKKUCGI-UHFFFAOYSA-N CC1C(=O)C(=C(O1)C)O
(2R/2S)-4-methoxy-2,5-dimethylfuran-3(2H)-one sum of isomers 61325 SIMKGHMLPVDSJE-UHFFFAOYSA-N CC1C(=O)C(=C(O1)C)OC
helional sum of isomers 64805 BOPPSUHPZARXTH-UHFFFAOYSA-N CC(CC1=CC2=C(C=C1)OCO2)C=O
CARVEOL sum of isomers 7438 BAVONGHXFVOKBV-UHFFFAOYSA-N CC1=CCC(CC1O)C(=C)C
3,7-dimethyl-6-octenoic acid sum of isomers 10402 GJWSUKYXUMVMGX-UHFFFAOYSA-N CC(CCC=C(C)C)CC(=O)O
1-octen-3-ol sum of isomers 18827 VSMOENVRRABVKN-UHFFFAOYSA-N CCCCCC(C=C)O
1,2-Dichloroethylene sum of isomers 10900 KFUSEUYYWQURPO-UHFFFAOYSA-N C(=CCl)Cl
Hydroxy-citronellal sum of isomers 7888 WPFVBOQKRVRMJB-UHFFFAOYSA-N CC(CCCC(C)(C)O)CC=O
tonalide sum of isomers 89440 DNRJTBAOUJJKDY-UHFFFAOYSA-N CC1CC(C2=C(C1(C)C)C=C(C(=C2)C(=O)C)C)(C) ...
cashmeran sum of isomers 92292 MIZGSAALSYARKU-UHFFFAOYSA-N CC1C(C2=C(C1(C)C)C(=O)CCC2)(C)C
3,7-Dimethyl-2,6-octadienal sum of isomers 8843 WTEVQBCEXWBHNA-UHFFFAOYSA-N CC(=CCCC(=CC=O)C)C