768
Unique InChIKey
1254
Unique Sequence
5834
EC50 Parameter
Results
Showing 241 to 270 of 51415 results
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | 3-pentanol | 11428 | 584-02-1 | AQIXEPGDORPWBJ-UHFFFAOYSA-N | CCC(CC)O | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | alpha-pinene | 6654 | 80-56-8 | GRWFGVWFFZKLTI-UHFFFAOYSA-N | CC1=CCC2CC1C2(C)C | sum of isomers | 1 | ec50 | ||
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | beta-pinene | 14896 | 127-91-3 | WTARULDDTDQWMU-UHFFFAOYSA-N | CC1(C2CCC(=C)C1C2)C | sum of isomers | 0 | ec50 | ||
mus musculus | Olfr175_Olfr175 | A0A140T8K4 | MTEDNYSLTTEFILI ... | 2-(Butan-2-yl)-3-methoxypyrazine | 520098 | QMQDJVIJVPEQHE-UHFFFAOYSA-N | CCC(C)C1=NC=CN=C1OC | sum of isomers | 0 | ec50 | |||
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | acetic acid | 176 | 64-19-7 | QTBSBXVTEAMEQO-UHFFFAOYSA-N | CC(=O)O | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | butyric acid | 264 | 107-92-6 | FERIUCNNQQJTOY-UHFFFAOYSA-N | CCCC(=O)O | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | coumarin | 323 | 91-64-5 | ZYGHJZDHTFUPRJ-UHFFFAOYSA-N | C1=CC=C2C(=C1)C=CC(=O)O2 | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | dodecanoic acid | 3893 | 143-07-7 | POULHZVOKOAJMA-UHFFFAOYSA-N | CCCCCCCCCCCC(=O)O | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | ethyl decanoate | 8048 | 110-38-3 | RGXWDWUGBIJHDO-UHFFFAOYSA-N | CCCCCCCCCC(=O)OCC | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | ethyl dodecanoate | 7800 | 106-33-2 | MMXKVMNBHPAILY-UHFFFAOYSA-N | CCCCCCCCCCCC(=O)OCC | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | ethyl hexadecanoate | 12366 | 628-97-7 | XIRNKXNNONJFQO-UHFFFAOYSA-N | CCCCCCCCCCCCCCCC(=O)OCC | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | ethyl octadecanoate | 8122 | 111-61-5 | MVLVMROFTAUDAG-UHFFFAOYSA-N | CCCCCCCCCCCCCCCCCC(=O)OCC | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | ethyl octanoate | 7799 | 106-32-1 | YYZUSRORWSJGET-UHFFFAOYSA-N | CCCCCCCC(=O)OCC | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | ethyl tetradecanoate | 31283 | 124-06-1 | MMKRHZKQPFCLLS-UHFFFAOYSA-N | CCCCCCCCCCCCCC(=O)OCC | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | eugenol | 3314 | 97-53-0 | RRAFCDWBNXTKKO-UHFFFAOYSA-N | COC1=C(C=CC(=C1)CC=C)O | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | farnesol | 445070 | 4602-84-0 | CRDAMVZIKSXKFV-YFVJMOTDSA-N | CC(=CCC/C(=C/CC/C(=C/CO)/C)/C)C | mono | 0 | ec50 | ||
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | geraniol | 637566 | 106-24-1 | GLZPCOQZEFWAFX-JXMROGBWSA-N | CC(=CCC/C(=C/CO)/C)C | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | heptanoic acid | 8094 | 111-14-8 | MNWFXJYAOYHMED-UHFFFAOYSA-N | CCCCCCC(=O)O | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | hexanoic acid | 8892 | 142-62-1 | FUZZWVXGSFPDMH-UHFFFAOYSA-N | CCCCCC(=O)O | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | isovaleric acid | 10430 | 503-74-2 | GWYFCOCPABKNJV-UHFFFAOYSA-N | CC(C)CC(=O)O | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | lactic acid | 612 | 50-21-5 | JVTAAEKCZFNVCJ-UHFFFAOYSA-N | CC(C(=O)O)O | sum of isomers | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | lilial | 228987 | 80-54-6 | SDQFDHOLCGWZPU-UHFFFAOYSA-N | CC(CC1=CC=C(C=C1)C(C)(C)C)C=O | sum of isomers | 1 | ec50 | ||
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | linalool | 6549 | 78-70-6 | CDOSHBSSFJOMGT-UHFFFAOYSA-N | CC(=CCCC(C)(C=C)O)C | sum of isomers | 0 | secondaryScreening | 2.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | lyral | 91604 | 31906-04-4 | ORMHZBNNECIKOH-UHFFFAOYSA-N | CC(C)(CCCC1=CCC(CC1)C=O)O | sum of isomers | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | melatonin | 896 | 73-31-4 | DRLFMBDRBRZALE-UHFFFAOYSA-N | CC(=O)NCCC1=CNC2=C1C=C(C=C2)OC | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | methyl decanoate | 8050 | 110-42-9 | YRHYCMZPEVDGFQ-UHFFFAOYSA-N | CCCCCCCCCC(=O)OC | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | methyl dodecanoate | 8139 | 111-82-0 | UQDUPQYQJKYHQI-UHFFFAOYSA-N | CCCCCCCCCCCC(=O)OC | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | methyl hexadecanoate | 8181 | 112-39-0 | FLIACVVOZYBSBS-UHFFFAOYSA-N | CCCCCCCCCCCCCCCC(=O)OC | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | methyl octadecanoate | 8201 | 112-61-8 | HPEUJPJOZXNMSJ-UHFFFAOYSA-N | CCCCCCCCCCCCCCCCCC(=O)OC | mono | 0 | primaryScreening | 1.0 | |
homo sapiens | OR2T4 | Q8NH00 | MDNITWMASHTGWSD ... | methyl octanoate | 8091 | 111-11-5 | JGHZJRVDZXSNKQ-UHFFFAOYSA-N | CCCCCCCC(=O)OC | mono | 0 | primaryScreening | 1.0 |